C13H12N2O2S2 — CID 8637772
N'-(4-methylsulfanylbenzoyl)thiophene-2-carbohydrazide (PubChem CID 8637772) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is N'-(4-methylsulfanylbenzoyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(4-methylsulfanylbenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8637772 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N'-(4-methylsulfanylbenzoyl)thiophene-2-carbohydrazide |
| SMILES | CSc1ccc(C(=O)NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H12N2O2S2/c1-18-10-6-4-9(5-7-10)12(16)14-15-13(17)11-3-2-8-19-11/h2-8H,1H3,(H,14,16)(H,15,17) |
| InChIKey | UYTQIBATIMUJDZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|