C6H8N4O2S — CID 141065921
1-amino-3-(thiophene-2-carbonylamino)urea (PubChem CID 141065921) has the molecular formula C6H8N4O2S and a molecular weight of 200.22 g/mol. Its IUPAC name is 1-amino-3-(thiophene-2-carbonylamino)urea.
| Compound Name | 1-amino-3-(thiophene-2-carbonylamino)urea |
|---|---|
| PubChem CID | 141065921 |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-amino-3-(thiophene-2-carbonylamino)urea |
| SMILES | NNC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C6H8N4O2S/c7-8-6(12)10-9-5(11)4-2-1-3-13-4/h1-3H,7H2,(H,9,11)(H2,8,10,12) |
| InChIKey | QNIHRRPJHVFOKZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|