C26H25FN4O3S — CID 5088860
4-tert-butyl-N-[4-[[(4-fluorobenzoyl)carbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 5088860) has the molecular formula C26H25FN4O3S and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[(4-fluorobenzoyl)carbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[(4-fluorobenzoyl)carbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5088860 |
| Molecular Formula | C26H25FN4O3S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-tert-butyl-N-[4-[[(4-fluorobenzoyl)carbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25FN4O3S/c1-26(2,3)19-10-4-16(5-11-19)22(32)28-21-14-8-18(9-15-21)24(34)30-31-25(35)29-23(33)17-6-12-20(27)13-7-17/h4-15H,1-3H3,(H,28,32)(H,30,34)(H2,29,31,33,35) |
| InChIKey | IBAZDRCBCRMVSC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|