C15H13FN4O3S — CID 9469568
1-(4-fluorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]thiourea (PubChem CID 9469568) has the molecular formula C15H13FN4O3S and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9469568 |
| Molecular Formula | C15H13FN4O3S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]thiourea |
| SMILES | Cc1cc(C(=O)NNC(=S)Nc2ccc(F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13FN4O3S/c1-9-8-10(2-7-13(9)20(22)23)14(21)18-19-15(24)17-12-5-3-11(16)4-6-12/h2-8H,1H3,(H,18,21)(H2,17,19,24) |
| InChIKey | NODKJFGMPDRPDR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|