C14H10F2N2O3 — CID 786997
N-(3,4-difluorophenyl)-3-methyl-4-nitrobenzamide (PubChem CID 786997) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(3,4-difluorophenyl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 786997 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10F2N2O3/c1-8-6-9(2-5-13(8)18(20)21)14(19)17-10-3-4-11(15)12(16)7-10/h2-7H,1H3,(H,17,19) |
| InChIKey | GLHLTSHFKQRRLY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|