C16H10N2O7-2 — CID 7278870
5-[(3-methyl-4-nitrobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 7278870) has the molecular formula C16H10N2O7-2 and a molecular weight of 342.26 g/mol. Its IUPAC name is 5-[(3-methyl-4-nitrobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[(3-methyl-4-nitrobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7278870 |
| Molecular Formula | C16H10N2O7-2 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 5-[(3-methyl-4-nitrobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | Cc1cc(C(=O)Nc2cc(C(=O)[O-])cc(C(=O)[O-])c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N2O7/c1-8-4-9(2-3-13(8)18(24)25)14(19)17-12-6-10(15(20)21)5-11(7-12)16(22)23/h2-7H,1H3,(H,17,19)(H,20,21)(H,22,23)/p-2 |
| InChIKey | PHDWSUOHFUVBFY-UHFFFAOYSA-L |
| XLogP | -0.12 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|