C11H13F3N2O3S — CID 62735221
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2,2,2-trifluoroacetamide (PubChem CID 62735221) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62735221 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1ccc(NC(=O)C(F)(F)F)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H13F3N2O3S/c1-7-4-5-8(15-10(17)11(12,13)14)6-9(7)20(18,19)16(2)3/h4-6H,1-3H3,(H,15,17) |
| InChIKey | OVNQDVZMTGWUBV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |