C21H35N3O3S — CID 56542928
2-[(2-tert-butylcyclohexyl)amino]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 56542928) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-[(2-tert-butylcyclohexyl)amino]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-[(2-tert-butylcyclohexyl)amino]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 56542928 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-[(2-tert-butylcyclohexyl)amino]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CNC2CCCCC2C(C)(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H35N3O3S/c1-15-11-12-16(13-19(15)28(26,27)24(5)6)23-20(25)14-22-18-10-8-7-9-17(18)21(2,3)4/h11-13,17-18,22H,7-10,14H2,1-6H3,(H,23,25) |
| InChIKey | XXBZOAOQRWIQEF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |