C19H29N3O3S2 — CID 96535035
2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 96535035) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 96535035 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCS[C@@H]3CCCC[C@@H]32)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H29N3O3S2/c1-14-8-9-15(12-18(14)27(24,25)21(2)3)20-19(23)13-22-10-11-26-17-7-5-4-6-16(17)22/h8-9,12,16-17H,4-7,10-11,13H2,1-3H3,(H,20,23)/t16-,17+/m0/s1 |
| InChIKey | NKJCUTHRRPOFAJ-DLBZAZTESA-N |
| XLogP | 2.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |