C15H20ClN3O5S — CID 119908447
1-[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 119908447) has the molecular formula C15H20ClN3O5S and a molecular weight of 389.86 g/mol. Its IUPAC name is 1-[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119908447 |
| Molecular Formula | C15H20ClN3O5S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)CN2CCCC2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C15H20ClN3O5S/c1-18(2)25(23,24)13-8-10(5-6-11(13)16)17-14(20)9-19-7-3-4-12(19)15(21)22/h5-6,8,12H,3-4,7,9H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | IBITYQVDTHELFQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |