C28H39N3O7 — CID 54452731
tert-butyl N-[3-(5-methyl-2-phenylmethoxyphenoxy)propoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 54452731) has the molecular formula C28H39N3O7 and a molecular weight of 529.63 g/mol. Its IUPAC name is tert-butyl N-[3-(5-methyl-2-phenylmethoxyphenoxy)propoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-methyl-2-phenylmethoxyphenoxy)propoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 54452731 |
| Molecular Formula | C28H39N3O7 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | tert-butyl N-[3-(5-methyl-2-phenylmethoxyphenoxy)propoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | Cc1ccc(OCc2ccccc2)c(OCCCON(C(=O)OC(C)(C)C)C(N)=NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H39N3O7/c1-20-14-15-22(35-19-21-12-9-8-10-13-21)23(18-20)34-16-11-17-36-31(26(33)38-28(5,6)7)24(29)30-25(32)37-27(2,3)4/h8-10,12-15,18H,11,16-17,19H2,1-7H3,(H2,29,30,32) |
| InChIKey | WWBNQLNCZMIHMQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 121.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|