C24H25NO6S — CID 54131327
tert-butyl N-(benzenesulfonyl)-N-(5-hydroxy-2-phenylmethoxyphenyl)carbamate (PubChem CID 54131327) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonyl)-N-(5-hydroxy-2-phenylmethoxyphenyl)carbamate.
| Compound Name | tert-butyl N-(benzenesulfonyl)-N-(5-hydroxy-2-phenylmethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 54131327 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | tert-butyl N-(benzenesulfonyl)-N-(5-hydroxy-2-phenylmethoxyphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cc(O)ccc1OCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25NO6S/c1-24(2,3)31-23(27)25(32(28,29)20-12-8-5-9-13-20)21-16-19(26)14-15-22(21)30-17-18-10-6-4-7-11-18/h4-16,26H,17H2,1-3H3 |
| InChIKey | NUOWOFSEYFACDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |