C31H31NO7S — CID 54337575
tert-butyl N-naphthalen-1-ylsulfonyl-N-[5-[[(2S)-oxiran-2-yl]methoxy]-2-phenylmethoxyphenyl]carbamate (PubChem CID 54337575) has the molecular formula C31H31NO7S and a molecular weight of 561.66 g/mol. Its IUPAC name is tert-butyl N-naphthalen-1-ylsulfonyl-N-[5-[[(2S)-oxiran-2-yl]methoxy]-2-phenylmethoxyphenyl]carbamate.
| Compound Name | tert-butyl N-naphthalen-1-ylsulfonyl-N-[5-[[(2S)-oxiran-2-yl]methoxy]-2-phenylmethoxyphenyl]carbamate |
|---|---|
| PubChem CID | 54337575 |
| Molecular Formula | C31H31NO7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | tert-butyl N-naphthalen-1-ylsulfonyl-N-[5-[[(2S)-oxiran-2-yl]methoxy]-2-phenylmethoxyphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cc(OC[C@@H]2CO2)ccc1OCc1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H31NO7S/c1-31(2,3)39-30(33)32(40(34,35)29-15-9-13-23-12-7-8-14-26(23)29)27-18-24(36-20-25-21-37-25)16-17-28(27)38-19-22-10-5-4-6-11-22/h4-18,25H,19-21H2,1-3H3/t25-/m1/s1 |
| InChIKey | TWOZZHQIWUTMIG-RUZDIDTESA-N |
| XLogP | 6.33 |
| TPSA | 94.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|