C25H26INO4 — CID 51031114
tert-butyl N-(1-iodo-4-phenylmethoxynaphthalen-2-yl)-N-[[(2S)-oxiran-2-yl]methyl]carbamate (PubChem CID 51031114) has the molecular formula C25H26INO4 and a molecular weight of 531.39 g/mol. Its IUPAC name is tert-butyl N-(1-iodo-4-phenylmethoxynaphthalen-2-yl)-N-[[(2S)-oxiran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-(1-iodo-4-phenylmethoxynaphthalen-2-yl)-N-[[(2S)-oxiran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 51031114 |
| Molecular Formula | C25H26INO4 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | tert-butyl N-(1-iodo-4-phenylmethoxynaphthalen-2-yl)-N-[[(2S)-oxiran-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@H]1CO1)c1cc(OCc2ccccc2)c2ccccc2c1I |
| InChI | InChI=1S/C25H26INO4/c1-25(2,3)31-24(28)27(14-18-16-29-18)21-13-22(30-15-17-9-5-4-6-10-17)19-11-7-8-12-20(19)23(21)26/h4-13,18H,14-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | KDHLWRIYHFJMAQ-SFHVURJKSA-N |
| XLogP | 6.16 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|