C29H32INO5 — CID 86757340
methyl (E)-6-[(1-iodo-4-phenylmethoxynaphthalen-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate (PubChem CID 86757340) has the molecular formula C29H32INO5 and a molecular weight of 601.48 g/mol. Its IUPAC name is methyl (E)-6-[(1-iodo-4-phenylmethoxynaphthalen-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate.
| Compound Name | methyl (E)-6-[(1-iodo-4-phenylmethoxynaphthalen-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate |
|---|---|
| PubChem CID | 86757340 |
| Molecular Formula | C29H32INO5 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | methyl (E)-6-[(1-iodo-4-phenylmethoxynaphthalen-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate |
| SMILES | COC(=O)/C=C/CCCN(C(=O)OC(C)(C)C)c1cc(OCc2ccccc2)c2ccccc2c1I |
| InChI | InChI=1S/C29H32INO5/c1-29(2,3)36-28(33)31(18-12-6-9-17-26(32)34-4)24-19-25(35-20-21-13-7-5-8-14-21)22-15-10-11-16-23(22)27(24)30/h5,7-11,13-17,19H,6,12,18,20H2,1-4H3/b17-9+ |
| InChIKey | QNERVYRYTFGLGI-RQZCQDPDSA-N |
| XLogP | 7.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|