C28H29BrN2O3 — CID 10673564
tert-butyl N-(1-bromo-7-cyano-4-phenylmethoxynaphthalen-2-yl)-N-(3-methylbut-2-enyl)carbamate (PubChem CID 10673564) has the molecular formula C28H29BrN2O3 and a molecular weight of 521.46 g/mol. Its IUPAC name is tert-butyl N-(1-bromo-7-cyano-4-phenylmethoxynaphthalen-2-yl)-N-(3-methylbut-2-enyl)carbamate.
| Compound Name | tert-butyl N-(1-bromo-7-cyano-4-phenylmethoxynaphthalen-2-yl)-N-(3-methylbut-2-enyl)carbamate |
|---|---|
| PubChem CID | 10673564 |
| Molecular Formula | C28H29BrN2O3 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | tert-butyl N-(1-bromo-7-cyano-4-phenylmethoxynaphthalen-2-yl)-N-(3-methylbut-2-enyl)carbamate |
| SMILES | CC(C)=CCN(C(=O)OC(C)(C)C)c1cc(OCc2ccccc2)c2ccc(C#N)cc2c1Br |
| InChI | InChI=1S/C28H29BrN2O3/c1-19(2)13-14-31(27(32)34-28(3,4)5)24-16-25(33-18-20-9-7-6-8-10-20)22-12-11-21(17-30)15-23(22)26(24)29/h6-13,15-16H,14,18H2,1-5H3 |
| InChIKey | SSISEJCUXZYQTC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|