C26H28INO4 — CID 10506753
tert-butyl N-(1-iodo-7-methoxy-4-phenylmethoxynaphthalen-2-yl)-N-prop-2-enylcarbamate (PubChem CID 10506753) has the molecular formula C26H28INO4 and a molecular weight of 545.42 g/mol. Its IUPAC name is tert-butyl N-(1-iodo-7-methoxy-4-phenylmethoxynaphthalen-2-yl)-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-(1-iodo-7-methoxy-4-phenylmethoxynaphthalen-2-yl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 10506753 |
| Molecular Formula | C26H28INO4 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | tert-butyl N-(1-iodo-7-methoxy-4-phenylmethoxynaphthalen-2-yl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)c1cc(OCc2ccccc2)c2ccc(OC)cc2c1I |
| InChI | InChI=1S/C26H28INO4/c1-6-14-28(25(29)32-26(2,3)4)22-16-23(31-17-18-10-8-7-9-11-18)20-13-12-19(30-5)15-21(20)24(22)27/h6-13,15-16H,1,14,17H2,2-5H3 |
| InChIKey | DODTYGOWMKVBSA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|