C22H26INO4 — CID 102053748
tert-butyl N-(2-iodo-5-phenylmethoxyphenyl)-N-[[(2R,3R)-3-methyloxiran-2-yl]methyl]carbamate (PubChem CID 102053748) has the molecular formula C22H26INO4 and a molecular weight of 495.36 g/mol. Its IUPAC name is tert-butyl N-(2-iodo-5-phenylmethoxyphenyl)-N-[[(2R,3R)-3-methyloxiran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-(2-iodo-5-phenylmethoxyphenyl)-N-[[(2R,3R)-3-methyloxiran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 102053748 |
| Molecular Formula | C22H26INO4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | tert-butyl N-(2-iodo-5-phenylmethoxyphenyl)-N-[[(2R,3R)-3-methyloxiran-2-yl]methyl]carbamate |
| SMILES | C[C@H]1O[C@@H]1CN(C(=O)OC(C)(C)C)c1cc(OCc2ccccc2)ccc1I |
| InChI | InChI=1S/C22H26INO4/c1-15-20(27-15)13-24(21(25)28-22(2,3)4)19-12-17(10-11-18(19)23)26-14-16-8-6-5-7-9-16/h5-12,15,20H,13-14H2,1-4H3/t15-,20-/m1/s1 |
| InChIKey | KGTMTKNXVNKRBW-FOIQADDNSA-N |
| XLogP | 5.40 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|