C20H25NO4 — CID 10472618
tert-butyl N-benzyl-N-(2,5-dimethoxyphenyl)carbamate (PubChem CID 10472618) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(2,5-dimethoxyphenyl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(2,5-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10472618 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl N-benzyl-N-(2,5-dimethoxyphenyl)carbamate |
| SMILES | COc1ccc(OC)c(N(Cc2ccccc2)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H25NO4/c1-20(2,3)25-19(22)21(14-15-9-7-6-8-10-15)17-13-16(23-4)11-12-18(17)24-5/h6-13H,14H2,1-5H3 |
| InChIKey | OLEIPXSWNSMSBP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |