C14H21NO4 — CID 115136466
3-(2,5-dimethoxy-N-methylanilino)-2,2-dimethylpropanoic acid (PubChem CID 115136466) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-N-methylanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2,5-dimethoxy-N-methylanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 115136466 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(2,5-dimethoxy-N-methylanilino)-2,2-dimethylpropanoic acid |
| SMILES | COc1ccc(OC)c(N(C)CC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-14(2,13(16)17)9-15(3)11-8-10(18-4)6-7-12(11)19-5/h6-8H,9H2,1-5H3,(H,16,17) |
| InChIKey | YKQLRRINQOXIKD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |