C14H19NO5 — CID 81368930
3-[(2,5-dimethoxybenzoyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 81368930) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(2,5-dimethoxybenzoyl)amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(2,5-dimethoxybenzoyl)amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 81368930 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[(2,5-dimethoxybenzoyl)amino]-2,2-dimethylpropanoic acid |
| SMILES | COc1ccc(OC)c(C(=O)NCC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C14H19NO5/c1-14(2,13(17)18)8-15-12(16)10-7-9(19-3)5-6-11(10)20-4/h5-7H,8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | KVCBZTRMFIDMNR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |