C19H20N2O7 — CID 119250353
3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 119250353) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is 3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 119250353 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2C(=O)NCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H20N2O7/c1-19(2,18(23)24)11-20-17(22)15-10-12(21(25)26)4-9-16(15)28-14-7-5-13(27-3)6-8-14/h4-10H,11H2,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | VJZNZRGDFPMDRH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|