C20H17BrN4O6 — CID 46429266
4-bromo-N'-[2-(4-methoxyphenoxy)-5-nitrobenzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 46429266) has the molecular formula C20H17BrN4O6 and a molecular weight of 489.28 g/mol. Its IUPAC name is 4-bromo-N'-[2-(4-methoxyphenoxy)-5-nitrobenzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[2-(4-methoxyphenoxy)-5-nitrobenzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 46429266 |
| Molecular Formula | C20H17BrN4O6 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 4-bromo-N'-[2-(4-methoxyphenoxy)-5-nitrobenzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2C(=O)NNC(=O)c2cc(Br)cn2C)cc1 |
| InChI | InChI=1S/C20H17BrN4O6/c1-24-11-12(21)9-17(24)20(27)23-22-19(26)16-10-13(25(28)29)3-8-18(16)31-15-6-4-14(30-2)5-7-15/h3-11H,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | PNFQGJGEMBMOEA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|