C24H22N2O8 — CID 32569142
ethyl 2-[3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]phenoxy]acetate (PubChem CID 32569142) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 32569142 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | ethyl 2-[3-[[2-(4-methoxyphenoxy)-5-nitrobenzoyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2Oc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C24H22N2O8/c1-3-32-23(27)15-33-20-6-4-5-16(13-20)25-24(28)21-14-17(26(29)30)7-12-22(21)34-19-10-8-18(31-2)9-11-19/h4-14H,3,15H2,1-2H3,(H,25,28) |
| InChIKey | FMNKAZHABDNIKL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|