C22H17N3O5S2 — CID 25150695
2-(4-methoxyphenoxy)-5-nitro-N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 25150695) has the molecular formula C22H17N3O5S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-5-nitro-N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 2-(4-methoxyphenoxy)-5-nitro-N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 25150695 |
| Molecular Formula | C22H17N3O5S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-(4-methoxyphenoxy)-5-nitro-N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2C(=O)NCc2csc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C22H17N3O5S2/c1-29-16-5-7-17(8-6-16)30-19-9-4-15(25(27)28)11-18(19)21(26)23-12-14-13-32-22(24-14)20-3-2-10-31-20/h2-11,13H,12H2,1H3,(H,23,26) |
| InChIKey | IHBSIIABGCBHCK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|