C12H10ClN3O3S — CID 61284015
2-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitrobenzamide (PubChem CID 61284015) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 61284015 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitrobenzamide |
| SMILES | Cc1nc(CNC(=O)c2cc([N+](=O)[O-])ccc2Cl)cs1 |
| InChI | InChI=1S/C12H10ClN3O3S/c1-7-15-8(6-20-7)5-14-12(17)10-4-9(16(18)19)2-3-11(10)13/h2-4,6H,5H2,1H3,(H,14,17) |
| InChIKey | NLQUCUBNCIHJDY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|