C13H13ClN4O3 — CID 71876524
2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide (PubChem CID 71876524) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 71876524 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide |
| SMILES | Cc1n[nH]c(C)c1CNC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H13ClN4O3/c1-7-11(8(2)17-16-7)6-15-13(19)10-5-9(18(20)21)3-4-12(10)14/h3-5H,6H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | SEICSRLLGVTCSZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|