C13H11ClN4O3 — CID 61052943
2-chloro-N-[(2-methylpyrimidin-4-yl)methyl]-5-nitrobenzamide (PubChem CID 61052943) has the molecular formula C13H11ClN4O3 and a molecular weight of 306.71 g/mol. Its IUPAC name is 2-chloro-N-[(2-methylpyrimidin-4-yl)methyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2-methylpyrimidin-4-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 61052943 |
| Molecular Formula | C13H11ClN4O3 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-chloro-N-[(2-methylpyrimidin-4-yl)methyl]-5-nitrobenzamide |
| SMILES | Cc1nccc(CNC(=O)c2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C13H11ClN4O3/c1-8-15-5-4-9(17-8)7-16-13(19)11-6-10(18(20)21)2-3-12(11)14/h2-6H,7H2,1H3,(H,16,19) |
| InChIKey | MHJBOGKNORWDBJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|