About 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide
4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide (PubChem CID 82832714) has the molecular formula C13H12Cl2N4O
and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide.
Molecular Properties
| Compound Name | 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide |
| PubChem CID | 82832714 |
| Molecular Formula | C13H12Cl2N4O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide |
| SMILES | Cc1nccc(CNC(=O)c2cc(Cl)c(N)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H12Cl2N4O/c1-7-17-3-2-9(19-7)6-18-13(20)8-4-10(14)12(16)11(15)5-8/h2-5H,6,16H2,1H3,(H,18,20) |
| InChIKey | YUCOEEDPSQACIH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide?
The IUPAC name of 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide (CID 82832714) is 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide.
What is the SMILES notation for 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide?
The canonical SMILES for 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide is Cc1nccc(CNC(=O)c2cc(Cl)c(N)c(Cl)c2)n1.
What is the InChIKey of 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide?
The InChIKey is YUCOEEDPSQACIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N4O/c1-7-17-3-2-9(19-7)6-18-13(20)8-4-10(14)12(16)11(15)5-8/h2-5H,6,16H2,1H3,(H,18,20).
What are the key properties of 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide?
4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide has a molecular weight of 311.17 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dichloro-N-[(2-methylpyrimidin-4-yl)methyl]benzamide is sourced from PubChem (CID 82832714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).