C11H10Cl2N4O2 — CID 82832642
4-amino-3,5-dichloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 82832642) has the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 82832642 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | Cc1noc(CNC(=O)c2cc(Cl)c(N)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H10Cl2N4O2/c1-5-16-9(19-17-5)4-15-11(18)6-2-7(12)10(14)8(13)3-6/h2-3H,4,14H2,1H3,(H,15,18) |
| InChIKey | VYGKVGGEPWFELR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|