C15H17N3O3 — CID 142290980
methyl 4-[(2-methylpyrimidin-4-yl)methylcarbamoyl]benzoate;molecular hydrogen (PubChem CID 142290980) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 4-[(2-methylpyrimidin-4-yl)methylcarbamoyl]benzoate;molecular hydrogen.
| Compound Name | methyl 4-[(2-methylpyrimidin-4-yl)methylcarbamoyl]benzoate;molecular hydrogen |
|---|---|
| PubChem CID | 142290980 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | methyl 4-[(2-methylpyrimidin-4-yl)methylcarbamoyl]benzoate;molecular hydrogen |
| SMILES | COC(=O)c1ccc(C(=O)NCc2ccnc(C)n2)cc1.[H][H] |
| InChI | InChI=1S/C15H15N3O3.H2/c1-10-16-8-7-13(18-10)9-17-14(19)11-3-5-12(6-4-11)15(20)21-2;/h3-8H,9H2,1-2H3,(H,17,19);1H |
| InChIKey | VVNDHCCBYMWSOJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |