C13H13N5O3 — CID 62161384
5-amino-N-[(2-methylpyrimidin-4-yl)methyl]-2-nitrobenzamide (PubChem CID 62161384) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-amino-N-[(2-methylpyrimidin-4-yl)methyl]-2-nitrobenzamide.
| Compound Name | 5-amino-N-[(2-methylpyrimidin-4-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 62161384 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-amino-N-[(2-methylpyrimidin-4-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1nccc(CNC(=O)c2cc(N)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H13N5O3/c1-8-15-5-4-10(17-8)7-16-13(19)11-6-9(14)2-3-12(11)18(20)21/h2-6H,7,14H2,1H3,(H,16,19) |
| InChIKey | FAKOPZJKEAMJRR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|