C15H17N5O3 — CID 75523773
1-(2,4-dimethyl-5-nitrophenyl)-3-[(2-methylpyrimidin-4-yl)methyl]urea (PubChem CID 75523773) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-(2,4-dimethyl-5-nitrophenyl)-3-[(2-methylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-(2,4-dimethyl-5-nitrophenyl)-3-[(2-methylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 75523773 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(2,4-dimethyl-5-nitrophenyl)-3-[(2-methylpyrimidin-4-yl)methyl]urea |
| SMILES | Cc1nccc(CNC(=O)Nc2cc([N+](=O)[O-])c(C)cc2C)n1 |
| InChI | InChI=1S/C15H17N5O3/c1-9-6-10(2)14(20(22)23)7-13(9)19-15(21)17-8-12-4-5-16-11(3)18-12/h4-7H,8H2,1-3H3,(H2,17,19,21) |
| InChIKey | LNAXLDZCWZZIKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|