C12H12N4O3S — CID 63114434
2-[(2-methylpyrimidin-4-yl)methylcarbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63114434) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-[(2-methylpyrimidin-4-yl)methylcarbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(2-methylpyrimidin-4-yl)methylcarbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114434 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(2-methylpyrimidin-4-yl)methylcarbamoylamino]thiophene-3-carboxylic acid |
| SMILES | Cc1nccc(CNC(=O)Nc2sccc2C(=O)O)n1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-13-4-2-8(15-7)6-14-12(19)16-10-9(11(17)18)3-5-20-10/h2-5H,6H2,1H3,(H,17,18)(H2,14,16,19) |
| InChIKey | JLRHLDVZCUALER-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |