C12H17N3O4S — CID 63114347
2-[2-(2-methylpropanoylamino)ethylcarbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63114347) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[2-(2-methylpropanoylamino)ethylcarbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[2-(2-methylpropanoylamino)ethylcarbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114347 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[2-(2-methylpropanoylamino)ethylcarbamoylamino]thiophene-3-carboxylic acid |
| SMILES | CC(C)C(=O)NCCNC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C12H17N3O4S/c1-7(2)9(16)13-4-5-14-12(19)15-10-8(11(17)18)3-6-20-10/h3,6-7H,4-5H2,1-2H3,(H,13,16)(H,17,18)(H2,14,15,19) |
| InChIKey | SDJUPERIEYSQMO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|