C11H14N2O3S — CID 113465789
2-[[(E)-pent-3-enyl]carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 113465789) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[[(E)-pent-3-enyl]carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(E)-pent-3-enyl]carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 113465789 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[[(E)-pent-3-enyl]carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | C/C=C/CCNC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C11H14N2O3S/c1-2-3-4-6-12-11(16)13-9-8(10(14)15)5-7-17-9/h2-3,5,7H,4,6H2,1H3,(H,14,15)(H2,12,13,16)/b3-2+ |
| InChIKey | JBZAMGCEYYJDPN-NSCUHMNNSA-N |
| XLogP | 2.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|