C9H11N3O5S — CID 83203568
2-(2-carbamoyloxyethylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 83203568) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-(2-carbamoyloxyethylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(2-carbamoyloxyethylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 83203568 |
| Molecular Formula | C9H11N3O5S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(2-carbamoyloxyethylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | NC(=O)OCCNC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C9H11N3O5S/c10-8(15)17-3-2-11-9(16)12-6-5(7(13)14)1-4-18-6/h1,4H,2-3H2,(H2,10,15)(H,13,14)(H2,11,12,16) |
| InChIKey | QANUNNWSJUMUPQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|