C13H19N3O3S — CID 63113931
2-(3-pyrrolidin-1-ylpropylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 63113931) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(3-pyrrolidin-1-ylpropylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(3-pyrrolidin-1-ylpropylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63113931 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3-pyrrolidin-1-ylpropylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(NCCCN1CCCC1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C13H19N3O3S/c17-12(18)10-4-9-20-11(10)15-13(19)14-5-3-8-16-6-1-2-7-16/h4,9H,1-3,5-8H2,(H,17,18)(H2,14,15,19) |
| InChIKey | YOZLHPCANCSIMP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|