C10H15N3O5S2 — CID 106340230
2-[3-(methanesulfonamido)propylcarbamoylamino]thiophene-3-carboxylic acid (PubChem CID 106340230) has the molecular formula C10H15N3O5S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylcarbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[3-(methanesulfonamido)propylcarbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 106340230 |
| Molecular Formula | C10H15N3O5S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylcarbamoylamino]thiophene-3-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C10H15N3O5S2/c1-20(17,18)12-5-2-4-11-10(16)13-8-7(9(14)15)3-6-19-8/h3,6,12H,2,4-5H2,1H3,(H,14,15)(H2,11,13,16) |
| InChIKey | QAJJKCILTYTHIN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|