C13H21N5O3S — CID 150007677
5-[3-(4-methylpiperazin-1-yl)propylcarbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 150007677) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-[3-(4-methylpiperazin-1-yl)propylcarbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[3-(4-methylpiperazin-1-yl)propylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 150007677 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-[3-(4-methylpiperazin-1-yl)propylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | CN1CCN(CCCNC(=O)Nc2sncc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H21N5O3S/c1-17-5-7-18(8-6-17)4-2-3-14-13(21)16-11-10(12(19)20)9-15-22-11/h9H,2-8H2,1H3,(H,19,20)(H2,14,16,21) |
| InChIKey | DCQBQEFNRRVUTH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|