C23H30F3N5O5S — CID 87099118
methyl [5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazol-4-yl] carbonate (PubChem CID 87099118) has the molecular formula C23H30F3N5O5S and a molecular weight of 545.58 g/mol. Its IUPAC name is methyl [5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazol-4-yl] carbonate.
| Compound Name | methyl [5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazol-4-yl] carbonate |
|---|---|
| PubChem CID | 87099118 |
| Molecular Formula | C23H30F3N5O5S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | methyl [5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazol-4-yl] carbonate |
| SMILES | COC(=O)Oc1c(OCc2c(F)cc(C)c(F)c2F)nsc1NC(=O)NCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C23H30F3N5O5S/c1-14-12-16(24)15(18(26)17(14)25)13-35-20-19(36-23(33)34-3)21(37-29-20)28-22(32)27-6-4-5-7-31-10-8-30(2)9-11-31/h12H,4-11,13H2,1-3H3,(H2,27,28,32) |
| InChIKey | QWSGMYWVYIJWGH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|