C21H25F3N4O5S — CID 18549918
5-[4-(3-hydroxypyrrolidin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid (PubChem CID 18549918) has the molecular formula C21H25F3N4O5S and a molecular weight of 502.52 g/mol. Its IUPAC name is 5-[4-(3-hydroxypyrrolidin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[4-(3-hydroxypyrrolidin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18549918 |
| Molecular Formula | C21H25F3N4O5S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 5-[4-(3-hydroxypyrrolidin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCCN3CCC(O)C3)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C21H25F3N4O5S/c1-11-8-14(22)13(17(24)16(11)23)10-33-18-15(20(30)31)19(34-27-18)26-21(32)25-5-2-3-6-28-7-4-12(29)9-28/h8,12,29H,2-7,9-10H2,1H3,(H,30,31)(H2,25,26,32) |
| InChIKey | JLMJHAYNEGRHSM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|