C24H31F3N4O5S — CID 87099042
methyl 5-[(4-hydroxy-5-piperidin-1-ylpentyl)carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate (PubChem CID 87099042) has the molecular formula C24H31F3N4O5S and a molecular weight of 544.60 g/mol. Its IUPAC name is methyl 5-[(4-hydroxy-5-piperidin-1-ylpentyl)carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 5-[(4-hydroxy-5-piperidin-1-ylpentyl)carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 87099042 |
| Molecular Formula | C24H31F3N4O5S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | methyl 5-[(4-hydroxy-5-piperidin-1-ylpentyl)carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1c(OCc2c(F)cc(C)c(F)c2F)nsc1NC(=O)NCCCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C24H31F3N4O5S/c1-14-11-17(25)16(20(27)19(14)26)13-36-21-18(23(33)35-2)22(37-30-21)29-24(34)28-8-6-7-15(32)12-31-9-4-3-5-10-31/h11,15,32H,3-10,12-13H2,1-2H3,(H2,28,29,34) |
| InChIKey | NXHHPBXWGZXXEJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|