C22H29F3N4O5S — CID 18550514
5-[[7-(dimethylamino)-6-hydroxyheptyl]carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550514) has the molecular formula C22H29F3N4O5S and a molecular weight of 518.56 g/mol. Its IUPAC name is 5-[[7-(dimethylamino)-6-hydroxyheptyl]carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[[7-(dimethylamino)-6-hydroxyheptyl]carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550514 |
| Molecular Formula | C22H29F3N4O5S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 5-[[7-(dimethylamino)-6-hydroxyheptyl]carbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCCCC(O)CN(C)C)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C22H29F3N4O5S/c1-12-9-15(23)14(18(25)17(12)24)11-34-19-16(21(31)32)20(35-28-19)27-22(33)26-8-6-4-5-7-13(30)10-29(2)3/h9,13,30H,4-8,10-11H2,1-3H3,(H,31,32)(H2,26,27,33) |
| InChIKey | WJPNFWPSBMQVCU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|