C17H19F3N4O4S — CID 18550497
5-(4-aminobutylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550497) has the molecular formula C17H19F3N4O4S and a molecular weight of 432.42 g/mol. Its IUPAC name is 5-(4-aminobutylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-(4-aminobutylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550497 |
| Molecular Formula | C17H19F3N4O4S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 5-(4-aminobutylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCCN)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C17H19F3N4O4S/c1-8-6-10(18)9(13(20)12(8)19)7-28-14-11(16(25)26)15(29-24-14)23-17(27)22-5-3-2-4-21/h6H,2-5,7,21H2,1H3,(H,25,26)(H2,22,23,27) |
| InChIKey | KTSNILRCXOTZAH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|