C22H29F3N6O3S — CID 10052189
5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 10052189) has the molecular formula C22H29F3N6O3S and a molecular weight of 514.57 g/mol. Its IUPAC name is 5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10052189 |
| Molecular Formula | C22H29F3N6O3S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 5-[4-(4-methylpiperazin-1-yl)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCCN3CCN(C)CC3)c2C(N)=O)c(F)c1F |
| InChI | InChI=1S/C22H29F3N6O3S/c1-13-11-15(23)14(18(25)17(13)24)12-34-20-16(19(26)32)21(35-29-20)28-22(33)27-5-3-4-6-31-9-7-30(2)8-10-31/h11H,3-10,12H2,1-2H3,(H2,26,32)(H2,27,28,33) |
| InChIKey | KGIWZLJPRFBUHW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|