C21H26BF2N5O3S — CID 144720618
3-[(2,6-difluoro-4-methylideneboranylphenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 144720618) has the molecular formula C21H26BF2N5O3S and a molecular weight of 477.35 g/mol. Its IUPAC name is 3-[(2,6-difluoro-4-methylideneboranylphenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(2,6-difluoro-4-methylideneboranylphenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 144720618 |
| Molecular Formula | C21H26BF2N5O3S |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 3-[(2,6-difluoro-4-methylideneboranylphenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | C=Bc1cc(F)c(COc2nsc(NC(=O)NCCCCN3CCCC3)c2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C21H26BF2N5O3S/c1-22-13-10-15(23)14(16(24)11-13)12-32-19-17(18(25)30)20(33-28-19)27-21(31)26-6-2-3-7-29-8-4-5-9-29/h10-11H,1-9,12H2,(H2,25,30)(H2,26,27,31) |
| InChIKey | PRNUAILSQQTSML-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|