C19H22BrF2IN5O3S- — CID 176945054
CID 176945054 (PubChem CID 176945054) has the molecular formula C19H22BrF2IN5O3S- and a molecular weight of 645.29 g/mol.
| Compound Name | CID 176945054 |
|---|---|
| PubChem CID | 176945054 |
| Molecular Formula | C19H22BrF2IN5O3S- |
| Molecular Weight | 645.29 g/mol |
| Exact Mass | 643.96 |
| IUPAC Name | — |
| SMILES | NC(=O)c1c(OCc2c(F)cc(Br)cc2F)nsc1NC(=O)NCCCCN1CCC[I-]1 |
| InChI | InChI=1S/C19H22BrF2IN5O3S/c20-11-8-13(21)12(14(22)9-11)10-31-17-15(16(24)29)18(32-27-17)26-19(30)25-5-1-2-6-28-7-3-4-23-28/h8-9H,1-7,10H2,(H2,24,29)(H2,25,26,30)/q-1 |
| InChIKey | TYAWGPBIAHZBQI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|