C20H23BrF3N5O3S — CID 10099054
3-[(4-bromo-2,3,6-trifluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 10099054) has the molecular formula C20H23BrF3N5O3S and a molecular weight of 550.40 g/mol. Its IUPAC name is 3-[(4-bromo-2,3,6-trifluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(4-bromo-2,3,6-trifluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10099054 |
| Molecular Formula | C20H23BrF3N5O3S |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 3-[(4-bromo-2,3,6-trifluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2c(F)cc(Br)c(F)c2F)nsc1NC(=O)NCCCCN1CCCC1 |
| InChI | InChI=1S/C20H23BrF3N5O3S/c21-12-9-13(22)11(15(23)16(12)24)10-32-18-14(17(25)30)19(33-28-18)27-20(31)26-5-1-2-6-29-7-3-4-8-29/h9H,1-8,10H2,(H2,25,30)(H2,26,27,31) |
| InChIKey | HCYLBNPHRUPOIC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|