C20H23ClF2N4O4S — CID 18549890
3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 18549890) has the molecular formula C20H23ClF2N4O4S and a molecular weight of 488.94 g/mol. Its IUPAC name is 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18549890 |
| Molecular Formula | C20H23ClF2N4O4S |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCCCN1CCCC1)Nc1snc(OCc2c(F)cc(Cl)cc2F)c1C(=O)O |
| InChI | InChI=1S/C20H23ClF2N4O4S/c21-12-9-14(22)13(15(23)10-12)11-31-17-16(19(28)29)18(32-26-17)25-20(30)24-5-1-2-6-27-7-3-4-8-27/h9-10H,1-8,11H2,(H,28,29)(H2,24,25,30) |
| InChIKey | VEBGEAZHSGUKMG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|